C14H19ClN4 — CID 79301434
2-(chloromethyl)-6-methyl-3-(1-methylpiperidin-3-yl)imidazo[4,5-b]pyridine (PubChem CID 79301434) has the molecular formula C14H19ClN4 and a molecular weight of 278.79 g/mol. Its IUPAC name is 2-(chloromethyl)-6-methyl-3-(1-methylpiperidin-3-yl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(chloromethyl)-6-methyl-3-(1-methylpiperidin-3-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79301434 |
| Molecular Formula | C14H19ClN4 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-(chloromethyl)-6-methyl-3-(1-methylpiperidin-3-yl)imidazo[4,5-b]pyridine |
| SMILES | Cc1cnc2c(c1)nc(CCl)n2C1CCCN(C)C1 |
| InChI | InChI=1S/C14H19ClN4/c1-10-6-12-14(16-8-10)19(13(7-15)17-12)11-4-3-5-18(2)9-11/h6,8,11H,3-5,7,9H2,1-2H3 |
| InChIKey | MONKHHNHAVGNJL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|