About 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one
7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one (PubChem CID 79301925) has the molecular formula C8H8BrN3O
and a molecular weight of 242.08 g/mol. Its IUPAC name is 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one |
| PubChem CID | 79301925 |
| Molecular Formula | C8H8BrN3O |
| Molecular Weight | 242.08 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one |
| SMILES | CC1Nc2ncc(Br)cc2NC1=O |
| InChI | InChI=1S/C8H8BrN3O/c1-4-8(13)12-6-2-5(9)3-10-7(6)11-4/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | BTHACVPWDJRCGM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.08 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
The IUPAC name of 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one (CID 79301925) is 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one.
What is the SMILES notation for 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
The canonical SMILES for 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one is CC1Nc2ncc(Br)cc2NC1=O.
What is the InChIKey of 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
The InChIKey is BTHACVPWDJRCGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN3O/c1-4-8(13)12-6-2-5(9)3-10-7(6)11-4/h2-4H,1H3,(H,10,11)(H,12,13).
What are the key properties of 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one has a molecular weight of 242.08 g/mol, XLogP of 1.60, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-methyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one is sourced from PubChem (CID 79301925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).