About 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine
2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine (PubChem CID 79302167) has the molecular formula C13H18BrClN4
and a molecular weight of 345.67 g/mol. Its IUPAC name is 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine |
| PubChem CID | 79302167 |
| Molecular Formula | C13H18BrClN4 |
| Molecular Weight | 345.67 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1c(CCl)nc2cc(Br)cnc21 |
| InChI | InChI=1S/C13H18BrClN4/c1-3-18(4-2)5-6-19-12(8-15)17-11-7-10(14)9-16-13(11)19/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | OMCIGCMZHWYMLD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine?
The IUPAC name of 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine (CID 79302167) is 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine.
What is the SMILES notation for 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine?
The canonical SMILES for 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine is CCN(CC)CCn1c(CCl)nc2cc(Br)cnc21.
What is the InChIKey of 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine?
The InChIKey is OMCIGCMZHWYMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrClN4/c1-3-18(4-2)5-6-19-12(8-15)17-11-7-10(14)9-16-13(11)19/h7,9H,3-6,8H2,1-2H3.
What are the key properties of 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine?
2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine has a molecular weight of 345.67 g/mol, XLogP of 3.27, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-N,N-diethylethanamine is sourced from PubChem (CID 79302167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).