C14H12BrClN4 — CID 79302307
6-bromo-2-(1-chloroethyl)-3-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 79302307) has the molecular formula C14H12BrClN4 and a molecular weight of 351.64 g/mol. Its IUPAC name is 6-bromo-2-(1-chloroethyl)-3-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 6-bromo-2-(1-chloroethyl)-3-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79302307 |
| Molecular Formula | C14H12BrClN4 |
| Molecular Weight | 351.64 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 6-bromo-2-(1-chloroethyl)-3-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | CC(Cl)c1nc2cc(Br)cnc2n1Cc1cccnc1 |
| InChI | InChI=1S/C14H12BrClN4/c1-9(16)13-19-12-5-11(15)7-18-14(12)20(13)8-10-3-2-4-17-6-10/h2-7,9H,8H2,1H3 |
| InChIKey | OWJVJOSEOMEAHC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|