C13H23N5O — CID 79304547
4-amino-1-ethyl-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrazole-5-carboxamide (PubChem CID 79304547) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrazole-5-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 79304547 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 4-amino-1-ethyl-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrazole-5-carboxamide |
| SMILES | CCn1ncc(N)c1C(=O)N(C)CC1CCCN1C |
| InChI | InChI=1S/C13H23N5O/c1-4-18-12(11(14)8-15-18)13(19)17(3)9-10-6-5-7-16(10)2/h8,10H,4-7,9,14H2,1-3H3 |
| InChIKey | DBJHBXHCMNHZLK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |