About 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine
1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine (PubChem CID 79304809) has the molecular formula C11H14N6S
and a molecular weight of 262.34 g/mol. Its IUPAC name is 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine.
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine |
| PubChem CID | 79304809 |
| Molecular Formula | C11H14N6S |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine |
| SMILES | CCn1nc(C)c2nc(N)n(Cc3nccs3)c21 |
| InChI | InChI=1S/C11H14N6S/c1-3-17-10-9(7(2)15-17)14-11(12)16(10)6-8-13-4-5-18-8/h4-5H,3,6H2,1-2H3,(H2,12,14) |
| InChIKey | AXWYDZIGGZKACA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine?
The IUPAC name of 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine (CID 79304809) is 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine.
What is the SMILES notation for 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine?
The canonical SMILES for 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine is CCn1nc(C)c2nc(N)n(Cc3nccs3)c21.
What is the InChIKey of 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine?
The InChIKey is AXWYDZIGGZKACA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N6S/c1-3-17-10-9(7(2)15-17)14-11(12)16(10)6-8-13-4-5-18-8/h4-5H,3,6H2,1-2H3,(H2,12,14).
What are the key properties of 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine?
1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine has a molecular weight of 262.34 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-6-(1,3-thiazol-2-ylmethyl)imidazo[4,5-d]pyrazol-5-amine is sourced from PubChem (CID 79304809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).