About 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine
6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine (PubChem CID 79305338) has the molecular formula C15H19N5
and a molecular weight of 269.35 g/mol. Its IUPAC name is 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine.
Molecular Properties
| Compound Name | 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine |
| PubChem CID | 79305338 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine |
| SMILES | CCn1nc(C)c2nc(N)n(-c3cc(C)cc(C)c3)c21 |
| InChI | InChI=1S/C15H19N5/c1-5-19-14-13(11(4)18-19)17-15(16)20(14)12-7-9(2)6-10(3)8-12/h6-8H,5H2,1-4H3,(H2,16,17) |
| InChIKey | JVFLRRKRMRJMDZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine?
The IUPAC name of 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine (CID 79305338) is 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine.
What is the SMILES notation for 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine?
The canonical SMILES for 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine is CCn1nc(C)c2nc(N)n(-c3cc(C)cc(C)c3)c21.
What is the InChIKey of 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine?
The InChIKey is JVFLRRKRMRJMDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5/c1-5-19-14-13(11(4)18-19)17-15(16)20(14)12-7-9(2)6-10(3)8-12/h6-8H,5H2,1-4H3,(H2,16,17).
What are the key properties of 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine?
6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine has a molecular weight of 269.35 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dimethylphenyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-5-amine is sourced from PubChem (CID 79305338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).