About 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one
7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one (PubChem CID 79305379) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one.
Molecular Properties
| Compound Name | 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one |
| PubChem CID | 79305379 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one |
| SMILES | CCCc1nn(C)c2c1NC(=O)CN2CCOC |
| InChI | InChI=1S/C12H20N4O2/c1-4-5-9-11-12(15(2)14-9)16(6-7-18-3)8-10(17)13-11/h4-8H2,1-3H3,(H,13,17) |
| InChIKey | PDNMTOOUUSYPQE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one?
The IUPAC name of 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one (CID 79305379) is 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one.
What is the SMILES notation for 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one?
The canonical SMILES for 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one is CCCc1nn(C)c2c1NC(=O)CN2CCOC.
What is the InChIKey of 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one?
The InChIKey is PDNMTOOUUSYPQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O2/c1-4-5-9-11-12(15(2)14-9)16(6-7-18-3)8-10(17)13-11/h4-8H2,1-3H3,(H,13,17).
What are the key properties of 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one?
7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one has a molecular weight of 252.32 g/mol, XLogP of 0.78, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-methoxyethyl)-1-methyl-3-propyl-4,6-dihydropyrazolo[4,5-b]pyrazin-5-one is sourced from PubChem (CID 79305379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).