C10H9BrF3N3OS — CID 79305885
6-bromo-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 79305885) has the molecular formula C10H9BrF3N3OS and a molecular weight of 356.17 g/mol. Its IUPAC name is 6-bromo-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 6-bromo-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 79305885 |
| Molecular Formula | C10H9BrF3N3OS |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | 6-bromo-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | FC(F)(F)COCCn1c(=S)[nH]c2cc(Br)cnc21 |
| InChI | InChI=1S/C10H9BrF3N3OS/c11-6-3-7-8(15-4-6)17(9(19)16-7)1-2-18-5-10(12,13)14/h3-4H,1-2,5H2,(H,16,19) |
| InChIKey | GLBOTMIDLAGFLZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|