C14H19BrN4S — CID 79306027
6-bromo-3-[(1-ethylpiperidin-4-yl)methyl]-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 79306027) has the molecular formula C14H19BrN4S and a molecular weight of 355.31 g/mol. Its IUPAC name is 6-bromo-3-[(1-ethylpiperidin-4-yl)methyl]-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 6-bromo-3-[(1-ethylpiperidin-4-yl)methyl]-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 79306027 |
| Molecular Formula | C14H19BrN4S |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 6-bromo-3-[(1-ethylpiperidin-4-yl)methyl]-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | CCN1CCC(Cn2c(=S)[nH]c3cc(Br)cnc32)CC1 |
| InChI | InChI=1S/C14H19BrN4S/c1-2-18-5-3-10(4-6-18)9-19-13-12(17-14(19)20)7-11(15)8-16-13/h7-8,10H,2-6,9H2,1H3,(H,17,20) |
| InChIKey | YNZUPILBECKVTR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|