C14H11BrFN3S — CID 79306380
6-bromo-3-[2-(2-fluorophenyl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 79306380) has the molecular formula C14H11BrFN3S and a molecular weight of 352.23 g/mol. Its IUPAC name is 6-bromo-3-[2-(2-fluorophenyl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 6-bromo-3-[2-(2-fluorophenyl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 79306380 |
| Molecular Formula | C14H11BrFN3S |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 6-bromo-3-[2-(2-fluorophenyl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Fc1ccccc1CCn1c(=S)[nH]c2cc(Br)cnc21 |
| InChI | InChI=1S/C14H11BrFN3S/c15-10-7-12-13(17-8-10)19(14(20)18-12)6-5-9-3-1-2-4-11(9)16/h1-4,7-8H,5-6H2,(H,18,20) |
| InChIKey | WFFLAAIHJPHZOZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|