C11H15N3O — CID 79307036
3,3,4,7-tetramethyl-1H-pyrido[2,3-b]pyrazin-2-one (PubChem CID 79307036) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 3,3,4,7-tetramethyl-1H-pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 3,3,4,7-tetramethyl-1H-pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 79307036 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3,3,4,7-tetramethyl-1H-pyrido[2,3-b]pyrazin-2-one |
| SMILES | Cc1cnc2c(c1)NC(=O)C(C)(C)N2C |
| InChI | InChI=1S/C11H15N3O/c1-7-5-8-9(12-6-7)14(4)11(2,3)10(15)13-8/h5-6H,1-4H3,(H,13,15) |
| InChIKey | AAOLSWGKKRIAEN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |