C14H24ClN5 — CID 79307730
4-[5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-dimethylbutan-1-amine (PubChem CID 79307730) has the molecular formula C14H24ClN5 and a molecular weight of 297.83 g/mol. Its IUPAC name is 4-[5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 79307730 |
| Molecular Formula | C14H24ClN5 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-[5-(chloromethyl)-1-ethyl-3-methylimidazo[4,5-d]pyrazol-6-yl]-N,N-dimethylbutan-1-amine |
| SMILES | CCn1nc(C)c2nc(CCl)n(CCCCN(C)C)c21 |
| InChI | InChI=1S/C14H24ClN5/c1-5-20-14-13(11(2)17-20)16-12(10-15)19(14)9-7-6-8-18(3)4/h5-10H2,1-4H3 |
| InChIKey | VILQMXHLFJXWFO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|