About 4-(1-chloropropyl)-1,2-dimethylcyclohexane
4-(1-chloropropyl)-1,2-dimethylcyclohexane (PubChem CID 79307796) has the molecular formula C11H21Cl
and a molecular weight of 188.74 g/mol. Its IUPAC name is 4-(1-chloropropyl)-1,2-dimethylcyclohexane.
Molecular Properties
| Compound Name | 4-(1-chloropropyl)-1,2-dimethylcyclohexane |
| PubChem CID | 79307796 |
| Molecular Formula | C11H21Cl |
| Molecular Weight | 188.74 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 4-(1-chloropropyl)-1,2-dimethylcyclohexane |
| SMILES | CCC(Cl)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C11H21Cl/c1-4-11(12)10-6-5-8(2)9(3)7-10/h8-11H,4-7H2,1-3H3 |
| InChIKey | KWOLWWSJXXVVFS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.74 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-chloropropyl)-1,2-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-chloropropyl)-1,2-dimethylcyclohexane?
The IUPAC name of 4-(1-chloropropyl)-1,2-dimethylcyclohexane (CID 79307796) is 4-(1-chloropropyl)-1,2-dimethylcyclohexane.
What is the SMILES notation for 4-(1-chloropropyl)-1,2-dimethylcyclohexane?
The canonical SMILES for 4-(1-chloropropyl)-1,2-dimethylcyclohexane is CCC(Cl)C1CCC(C)C(C)C1.
What is the InChIKey of 4-(1-chloropropyl)-1,2-dimethylcyclohexane?
The InChIKey is KWOLWWSJXXVVFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21Cl/c1-4-11(12)10-6-5-8(2)9(3)7-10/h8-11H,4-7H2,1-3H3.
What are the key properties of 4-(1-chloropropyl)-1,2-dimethylcyclohexane?
4-(1-chloropropyl)-1,2-dimethylcyclohexane has a molecular weight of 188.74 g/mol, XLogP of 4.08, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-chloropropyl)-1,2-dimethylcyclohexane is sourced from PubChem (CID 79307796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).