About 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one
1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one (PubChem CID 793095) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one |
| PubChem CID | 793095 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one |
| SMILES | CCC(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C9H14N2O/c1-5-8(12)9-6(2)10-11(4)7(9)3/h5H2,1-4H3 |
| InChIKey | XYCNZUWSRXFCSZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one?
The IUPAC name of 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one (CID 793095) is 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one.
What is the SMILES notation for 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one?
The canonical SMILES for 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one is CCC(=O)c1c(C)nn(C)c1C.
What is the InChIKey of 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one?
The InChIKey is XYCNZUWSRXFCSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-5-8(12)9-6(2)10-11(4)7(9)3/h5H2,1-4H3.
What are the key properties of 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one?
1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one has a molecular weight of 166.22 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3,5-trimethylpyrazol-4-yl)propan-1-one is sourced from PubChem (CID 793095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).