C18H28N2O — CID 79309851
3-ethyl-2-(3-phenoxypropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 79309851) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 3-ethyl-2-(3-phenoxypropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 3-ethyl-2-(3-phenoxypropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79309851 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 3-ethyl-2-(3-phenoxypropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CCC1CN2CCCC2CN1CCCOc1ccccc1 |
| InChI | InChI=1S/C18H28N2O/c1-2-16-14-20-11-6-8-17(20)15-19(16)12-7-13-21-18-9-4-3-5-10-18/h3-5,9-10,16-17H,2,6-8,11-15H2,1H3 |
| InChIKey | ULCZCPJUCGWSFY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|