C23H24N2O3 — CID 7930994
ethyl 5-(benzhydrylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 7930994) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl 5-(benzhydrylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-(benzhydrylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7930994 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | ethyl 5-(benzhydrylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)NC(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C23H24N2O3/c1-4-28-23(27)19-15(2)20(24-16(19)3)22(26)25-21(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,21,24H,4H2,1-3H3,(H,25,26) |
| InChIKey | XBRDHNKXVSPNBA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |