C18H17ClFNO3 — CID 7931119
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-methyl-2-phenylpropanoate (PubChem CID 7931119) has the molecular formula C18H17ClFNO3 and a molecular weight of 349.79 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-methyl-2-phenylpropanoate.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 7931119 |
| Molecular Formula | C18H17ClFNO3 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-methyl-2-phenylpropanoate |
| SMILES | CC(C)(C(=O)OCC(=O)Nc1ccc(F)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H17ClFNO3/c1-18(2,12-6-4-3-5-7-12)17(23)24-11-16(22)21-15-9-8-13(20)10-14(15)19/h3-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | GGNQMOZCPOGDAX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |