C15H24N4S — CID 79314276
4,6-dimethyl-2-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]pyridine-3-carbothioamide (PubChem CID 79314276) has the molecular formula C15H24N4S and a molecular weight of 292.45 g/mol. Its IUPAC name is 4,6-dimethyl-2-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]pyridine-3-carbothioamide.
| Compound Name | 4,6-dimethyl-2-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79314276 |
| Molecular Formula | C15H24N4S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 4,6-dimethyl-2-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]pyridine-3-carbothioamide |
| SMILES | Cc1cc(C)c(C(N)=S)c(N(C)CC2CCCN2C)n1 |
| InChI | InChI=1S/C15H24N4S/c1-10-8-11(2)17-15(13(10)14(16)20)19(4)9-12-6-5-7-18(12)3/h8,12H,5-7,9H2,1-4H3,(H2,16,20) |
| InChIKey | CFIOBFXMYIBQAN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|