About 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole
1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole (PubChem CID 79316170) has the molecular formula C12H17N7
and a molecular weight of 259.32 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole |
| PubChem CID | 79316170 |
| Molecular Formula | C12H17N7 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole |
| SMILES | c1c(-c2n[nH]c(C3CCCC3)n2)nnn1C1CNC1 |
| InChI | InChI=1S/C12H17N7/c1-2-4-8(3-1)11-14-12(17-16-11)10-7-19(18-15-10)9-5-13-6-9/h7-9,13H,1-6H2,(H,14,16,17) |
| InChIKey | RGDXARCXGUUWQX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole?
The IUPAC name of 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole (CID 79316170) is 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole.
What is the SMILES notation for 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole?
The canonical SMILES for 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole is c1c(-c2n[nH]c(C3CCCC3)n2)nnn1C1CNC1.
What is the InChIKey of 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole?
The InChIKey is RGDXARCXGUUWQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N7/c1-2-4-8(3-1)11-14-12(17-16-11)10-7-19(18-15-10)9-5-13-6-9/h7-9,13H,1-6H2,(H,14,16,17).
What are the key properties of 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole?
1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole has a molecular weight of 259.32 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)-4-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)triazole is sourced from PubChem (CID 79316170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).