About ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate
ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate (PubChem CID 79317539) has the molecular formula C11H16N6O3
and a molecular weight of 280.29 g/mol. Its IUPAC name is ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate |
| PubChem CID | 79317539 |
| Molecular Formula | C11H16N6O3 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate |
| SMILES | CCOC(=O)c1nnnn1Cc1noc(CC(C)C)n1 |
| InChI | InChI=1S/C11H16N6O3/c1-4-19-11(18)10-13-15-16-17(10)6-8-12-9(20-14-8)5-7(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | WBAHQBVLMVMKFB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 108.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate?
The IUPAC name of ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate (CID 79317539) is ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate.
What is the SMILES notation for ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate?
The canonical SMILES for ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate is CCOC(=O)c1nnnn1Cc1noc(CC(C)C)n1.
What is the InChIKey of ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate?
The InChIKey is WBAHQBVLMVMKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6O3/c1-4-19-11(18)10-13-15-16-17(10)6-8-12-9(20-14-8)5-7(2)3/h7H,4-6H2,1-3H3.
What are the key properties of ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate?
ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate has a molecular weight of 280.29 g/mol, XLogP of 0.48, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl]tetrazole-5-carboxylate is sourced from PubChem (CID 79317539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).