C12H14N2O7 — CID 7931792
ethyl N-[2-(2-methoxy-5-nitrophenoxy)acetyl]carbamate (PubChem CID 7931792) has the molecular formula C12H14N2O7 and a molecular weight of 298.25 g/mol. Its IUPAC name is ethyl N-[2-(2-methoxy-5-nitrophenoxy)acetyl]carbamate.
| Compound Name | ethyl N-[2-(2-methoxy-5-nitrophenoxy)acetyl]carbamate |
|---|---|
| PubChem CID | 7931792 |
| Molecular Formula | C12H14N2O7 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | ethyl N-[2-(2-methoxy-5-nitrophenoxy)acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)COc1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C12H14N2O7/c1-3-20-12(16)13-11(15)7-21-10-6-8(14(17)18)4-5-9(10)19-2/h4-6H,3,7H2,1-2H3,(H,13,15,16) |
| InChIKey | DKILDUIAYYKAOB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|