C11H21N5S — CID 79318804
4-ethyl-3-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]-1H-1,2,4-triazole-5-thione (PubChem CID 79318804) has the molecular formula C11H21N5S and a molecular weight of 255.39 g/mol. Its IUPAC name is 4-ethyl-3-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 79318804 |
| Molecular Formula | C11H21N5S |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-ethyl-3-[methyl-[(1-methylpyrrolidin-2-yl)methyl]amino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(N(C)CC2CCCN2C)n[nH]c1=S |
| InChI | InChI=1S/C11H21N5S/c1-4-16-10(12-13-11(16)17)15(3)8-9-6-5-7-14(9)2/h9H,4-8H2,1-3H3,(H,13,17) |
| InChIKey | XGWHAGFUVSIDLJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|