C12H19N3O4 — CID 79319754
4-[[methyl-[(1-methylpyrrolidin-2-yl)methyl]carbamoyl]amino]-4-oxobut-2-enoic acid (PubChem CID 79319754) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-[[methyl-[(1-methylpyrrolidin-2-yl)methyl]carbamoyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[methyl-[(1-methylpyrrolidin-2-yl)methyl]carbamoyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 79319754 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-[[methyl-[(1-methylpyrrolidin-2-yl)methyl]carbamoyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CN(CC1CCCN1C)C(=O)NC(=O)C=CC(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-14-7-3-4-9(14)8-15(2)12(19)13-10(16)5-6-11(17)18/h5-6,9H,3-4,7-8H2,1-2H3,(H,17,18)(H,13,16,19) |
| InChIKey | JGFVJHWYCNSAFC-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|