C16H26FN3 — CID 79319992
2-(ethylaminomethyl)-4-fluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline (PubChem CID 79319992) has the molecular formula C16H26FN3 and a molecular weight of 279.40 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-4-fluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline.
| Compound Name | 2-(ethylaminomethyl)-4-fluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 79319992 |
| Molecular Formula | C16H26FN3 |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 2-(ethylaminomethyl)-4-fluoro-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline |
| SMILES | CCNCc1cc(F)ccc1N(C)CC1CCCN1C |
| InChI | InChI=1S/C16H26FN3/c1-4-18-11-13-10-14(17)7-8-16(13)20(3)12-15-6-5-9-19(15)2/h7-8,10,15,18H,4-6,9,11-12H2,1-3H3 |
| InChIKey | FGAGIRTVFURISV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |