C16H19NO2 — CID 79320467
3'-propan-2-ylspiro[1,3-dihydroindene-2,4'-piperidine]-2',6'-dione (PubChem CID 79320467) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3'-propan-2-ylspiro[1,3-dihydroindene-2,4'-piperidine]-2',6'-dione.
| Compound Name | 3'-propan-2-ylspiro[1,3-dihydroindene-2,4'-piperidine]-2',6'-dione |
|---|---|
| PubChem CID | 79320467 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3'-propan-2-ylspiro[1,3-dihydroindene-2,4'-piperidine]-2',6'-dione |
| SMILES | CC(C)C1C(=O)NC(=O)CC12Cc1ccccc1C2 |
| InChI | InChI=1S/C16H19NO2/c1-10(2)14-15(19)17-13(18)9-16(14)7-11-5-3-4-6-12(11)8-16/h3-6,10,14H,7-9H2,1-2H3,(H,17,18,19) |
| InChIKey | VHFKHANLPYGUFK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|