C14H15F2NO2 — CID 79321149
4-(2,4-difluorophenyl)-3-propan-2-ylpiperidine-2,6-dione (PubChem CID 79321149) has the molecular formula C14H15F2NO2 and a molecular weight of 267.27 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-3-propan-2-ylpiperidine-2,6-dione.
| Compound Name | 4-(2,4-difluorophenyl)-3-propan-2-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 79321149 |
| Molecular Formula | C14H15F2NO2 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-(2,4-difluorophenyl)-3-propan-2-ylpiperidine-2,6-dione |
| SMILES | CC(C)C1C(=O)NC(=O)CC1c1ccc(F)cc1F |
| InChI | InChI=1S/C14H15F2NO2/c1-7(2)13-10(6-12(18)17-14(13)19)9-4-3-8(15)5-11(9)16/h3-5,7,10,13H,6H2,1-2H3,(H,17,18,19) |
| InChIKey | RWVSRYDQURRMAU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|