C19H20N2O4S — CID 7932197
[2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate (PubChem CID 7932197) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is [2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7932197 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate |
| SMILES | COc1ccc(-c2csc(NC(=O)COC(=O)[C@H]3CC=CCC3)n2)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-24-15-9-7-13(8-10-15)16-12-26-19(20-16)21-17(22)11-25-18(23)14-5-3-2-4-6-14/h2-3,7-10,12,14H,4-6,11H2,1H3,(H,20,21,22)/t14-/m0/s1 |
| InChIKey | WUWFOFAPQNBUFV-AWEZNQCLSA-N |
| XLogP | 3.66 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|