About 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene
1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene (PubChem CID 79323104) has the molecular formula C12H15Cl
and a molecular weight of 194.70 g/mol. Its IUPAC name is 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene.
Molecular Properties
| Compound Name | 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene |
| PubChem CID | 79323104 |
| Molecular Formula | C12H15Cl |
| Molecular Weight | 194.70 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C=CCCl)cc1C |
| InChI | InChI=1S/C12H15Cl/c1-9-7-11(3)12(5-4-6-13)8-10(9)2/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | JMVWLZZCROHMQL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene?
The IUPAC name of 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene (CID 79323104) is 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene.
What is the SMILES notation for 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene?
The canonical SMILES for 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene is Cc1cc(C)c(C=CCCl)cc1C.
What is the InChIKey of 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene?
The InChIKey is JMVWLZZCROHMQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl/c1-9-7-11(3)12(5-4-6-13)8-10(9)2/h4-5,7-8H,6H2,1-3H3.
What are the key properties of 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene?
1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene has a molecular weight of 194.70 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloroprop-1-enyl)-2,4,5-trimethylbenzene is sourced from PubChem (CID 79323104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).