About 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran
2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran (PubChem CID 79323442) has the molecular formula C9H13ClO
and a molecular weight of 172.65 g/mol. Its IUPAC name is 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran |
| PubChem CID | 79323442 |
| Molecular Formula | C9H13ClO |
| Molecular Weight | 172.65 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran |
| SMILES | C/C(=C\C1CCC=CO1)CCl |
| InChI | InChI=1S/C9H13ClO/c1-8(7-10)6-9-4-2-3-5-11-9/h3,5-6,9H,2,4,7H2,1H3/b8-6+ |
| InChIKey | MWXPHWNBAMKDJT-SOFGYWHQSA-N |
| XLogP | 2.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran?
The IUPAC name of 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran (CID 79323442) is 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran.
What is the SMILES notation for 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran?
The canonical SMILES for 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran is C/C(=C\C1CCC=CO1)CCl.
What is the InChIKey of 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran?
The InChIKey is MWXPHWNBAMKDJT-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H13ClO/c1-8(7-10)6-9-4-2-3-5-11-9/h3,5-6,9H,2,4,7H2,1H3/b8-6+.
What are the key properties of 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran?
2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran has a molecular weight of 172.65 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-3-chloro-2-methylprop-1-enyl]-3,4-dihydro-2H-pyran is sourced from PubChem (CID 79323442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).