C12H16N2O4 — CID 79324531
1-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 79324531) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79324531 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cccn1CC(=O)N1CCC(O)CC1 |
| InChI | InChI=1S/C12H16N2O4/c15-9-3-6-13(7-4-9)11(16)8-14-5-1-2-10(14)12(17)18/h1-2,5,9,15H,3-4,6-8H2,(H,17,18) |
| InChIKey | GUZZPODSCNMXDN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |