C14H27N3O — CID 79328192
2-(4-aminopiperidin-1-yl)-1-(2-methylazepan-1-yl)ethanone (PubChem CID 79328192) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-1-(2-methylazepan-1-yl)ethanone.
| Compound Name | 2-(4-aminopiperidin-1-yl)-1-(2-methylazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 79328192 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-1-(2-methylazepan-1-yl)ethanone |
| SMILES | CC1CCCCCN1C(=O)CN1CCC(N)CC1 |
| InChI | InChI=1S/C14H27N3O/c1-12-5-3-2-4-8-17(12)14(18)11-16-9-6-13(15)7-10-16/h12-13H,2-11,15H2,1H3 |
| InChIKey | NCPWPLBMEMTRKC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |