About 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine
2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine (PubChem CID 79328932) has the molecular formula C12H15Cl2N
and a molecular weight of 244.17 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine.
Molecular Properties
| Compound Name | 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine |
| PubChem CID | 79328932 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine |
| SMILES | CCC(=Cc1cccc(Cl)c1Cl)CNC |
| InChI | InChI=1S/C12H15Cl2N/c1-3-9(8-15-2)7-10-5-4-6-11(13)12(10)14/h4-7,15H,3,8H2,1-2H3 |
| InChIKey | MFJPFDGRDGFTLU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine?
The IUPAC name of 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine (CID 79328932) is 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine.
What is the SMILES notation for 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine?
The canonical SMILES for 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine is CCC(=Cc1cccc(Cl)c1Cl)CNC.
What is the InChIKey of 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine?
The InChIKey is MFJPFDGRDGFTLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2N/c1-3-9(8-15-2)7-10-5-4-6-11(13)12(10)14/h4-7,15H,3,8H2,1-2H3.
What are the key properties of 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine?
2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine has a molecular weight of 244.17 g/mol, XLogP of 4.01, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dichlorophenyl)methylidene]-N-methylbutan-1-amine is sourced from PubChem (CID 79328932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).