C15H22BrN — CID 79329444
2-[(4-bromo-3-methylphenyl)methylidene]-N-propylbutan-1-amine (PubChem CID 79329444) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is 2-[(4-bromo-3-methylphenyl)methylidene]-N-propylbutan-1-amine.
| Compound Name | 2-[(4-bromo-3-methylphenyl)methylidene]-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 79329444 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[(4-bromo-3-methylphenyl)methylidene]-N-propylbutan-1-amine |
| SMILES | CCCNCC(=Cc1ccc(Br)c(C)c1)CC |
| InChI | InChI=1S/C15H22BrN/c1-4-8-17-11-13(5-2)10-14-6-7-15(16)12(3)9-14/h6-7,9-10,17H,4-5,8,11H2,1-3H3 |
| InChIKey | RTEHBAGNVDQTAY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|