About 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine
2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine (PubChem CID 79329546) has the molecular formula C12H20N2S
and a molecular weight of 224.37 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine.
Molecular Properties
| Compound Name | 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine |
| PubChem CID | 79329546 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine |
| SMILES | CCNCC(=Cc1sc(C)nc1C)CC |
| InChI | InChI=1S/C12H20N2S/c1-5-11(8-13-6-2)7-12-9(3)14-10(4)15-12/h7,13H,5-6,8H2,1-4H3 |
| InChIKey | YGLLEFNTSRFWOQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine?
The IUPAC name of 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine (CID 79329546) is 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine.
What is the SMILES notation for 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine?
The canonical SMILES for 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine is CCNCC(=Cc1sc(C)nc1C)CC.
What is the InChIKey of 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine?
The InChIKey is YGLLEFNTSRFWOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2S/c1-5-11(8-13-6-2)7-12-9(3)14-10(4)15-12/h7,13H,5-6,8H2,1-4H3.
What are the key properties of 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine?
2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine has a molecular weight of 224.37 g/mol, XLogP of 3.16, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]-N-ethylbutan-1-amine is sourced from PubChem (CID 79329546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).