C14H19N — CID 79329807
N-(2-benzylidenebutyl)cyclopropanamine (PubChem CID 79329807) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is N-(2-benzylidenebutyl)cyclopropanamine.
| Compound Name | N-(2-benzylidenebutyl)cyclopropanamine |
|---|---|
| PubChem CID | 79329807 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N-(2-benzylidenebutyl)cyclopropanamine |
| SMILES | CCC(=Cc1ccccc1)CNC1CC1 |
| InChI | InChI=1S/C14H19N/c1-2-12(11-15-14-8-9-14)10-13-6-4-3-5-7-13/h3-7,10,14-15H,2,8-9,11H2,1H3 |
| InChIKey | LHPFUDHBYFBCEV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |