About 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol
7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol (PubChem CID 79330754) has the molecular formula C13H14F2O
and a molecular weight of 224.25 g/mol. Its IUPAC name is 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol.
Molecular Properties
| Compound Name | 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol |
| PubChem CID | 79330754 |
| Molecular Formula | C13H14F2O |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol |
| SMILES | OC1(c2cc(F)ccc2F)C2CCCCC21 |
| InChI | InChI=1S/C13H14F2O/c14-8-5-6-12(15)11(7-8)13(16)9-3-1-2-4-10(9)13/h5-7,9-10,16H,1-4H2 |
| InChIKey | CSULEDAKASGAGV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol?
The IUPAC name of 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol (CID 79330754) is 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol.
What is the SMILES notation for 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol?
The canonical SMILES for 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol is OC1(c2cc(F)ccc2F)C2CCCCC21.
What is the InChIKey of 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol?
The InChIKey is CSULEDAKASGAGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2O/c14-8-5-6-12(15)11(7-8)13(16)9-3-1-2-4-10(9)13/h5-7,9-10,16H,1-4H2.
What are the key properties of 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol?
7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol has a molecular weight of 224.25 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,5-difluorophenyl)bicyclo[4.1.0]heptan-7-ol is sourced from PubChem (CID 79330754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).