About 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid
2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid (PubChem CID 79331238) has the molecular formula C12H13N3O5
and a molecular weight of 279.25 g/mol. Its IUPAC name is 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid |
| PubChem CID | 79331238 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cccc1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H13N3O5/c16-9-4-3-7(11(19)14-9)13-12(20)8-2-1-5-15(8)6-10(17)18/h1-2,5,7H,3-4,6H2,(H,13,20)(H,17,18)(H,14,16,19) |
| InChIKey | GBDUPSFBCBUNSC-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid?
The IUPAC name of 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid (CID 79331238) is 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid.
What is the SMILES notation for 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid?
The canonical SMILES for 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid is O=C(O)Cn1cccc1C(=O)NC1CCC(=O)NC1=O.
What is the InChIKey of 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid?
The InChIKey is GBDUPSFBCBUNSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O5/c16-9-4-3-7(11(19)14-9)13-12(20)8-2-1-5-15(8)6-10(17)18/h1-2,5,7H,3-4,6H2,(H,13,20)(H,17,18)(H,14,16,19).
What are the key properties of 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid?
2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid has a molecular weight of 279.25 g/mol, XLogP of -0.89, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2,6-dioxopiperidin-3-yl)carbamoyl]pyrrol-1-yl]acetic acid is sourced from PubChem (CID 79331238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).