C13H16ClN — CID 79331696
6-[(2-chlorophenyl)methyl]bicyclo[3.1.0]hexan-6-amine (PubChem CID 79331696) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)methyl]bicyclo[3.1.0]hexan-6-amine.
| Compound Name | 6-[(2-chlorophenyl)methyl]bicyclo[3.1.0]hexan-6-amine |
|---|---|
| PubChem CID | 79331696 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 6-[(2-chlorophenyl)methyl]bicyclo[3.1.0]hexan-6-amine |
| SMILES | NC1(Cc2ccccc2Cl)C2CCCC21 |
| InChI | InChI=1S/C13H16ClN/c14-12-7-2-1-4-9(12)8-13(15)10-5-3-6-11(10)13/h1-2,4,7,10-11H,3,5-6,8,15H2 |
| InChIKey | VDOJZEHXWXMKGU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |