About 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide
4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide (PubChem CID 79335938) has the molecular formula C13H12ClFN2O3
and a molecular weight of 298.70 g/mol. Its IUPAC name is 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide.
Molecular Properties
| Compound Name | 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide |
| PubChem CID | 79335938 |
| Molecular Formula | C13H12ClFN2O3 |
| Molecular Weight | 298.70 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide |
| SMILES | CNC(=O)CCCN1C(=O)C(=O)c2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C13H12ClFN2O3/c1-16-11(18)3-2-4-17-10-6-9(15)8(14)5-7(10)12(19)13(17)20/h5-6H,2-4H2,1H3,(H,16,18) |
| InChIKey | HTOPNNZIECKULB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.70 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide?
The IUPAC name of 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide (CID 79335938) is 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide.
What is the SMILES notation for 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide?
The canonical SMILES for 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide is CNC(=O)CCCN1C(=O)C(=O)c2cc(Cl)c(F)cc21.
What is the InChIKey of 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide?
The InChIKey is HTOPNNZIECKULB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClFN2O3/c1-16-11(18)3-2-4-17-10-6-9(15)8(14)5-7(10)12(19)13(17)20/h5-6H,2-4H2,1H3,(H,16,18).
What are the key properties of 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide?
4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide has a molecular weight of 298.70 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-N-methylbutanamide is sourced from PubChem (CID 79335938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).