C12H10ClF3N2O2 — CID 79336093
5-chloro-6-[methyl(3,3,3-trifluoropropyl)amino]-1H-indole-2,3-dione (PubChem CID 79336093) has the molecular formula C12H10ClF3N2O2 and a molecular weight of 306.67 g/mol. Its IUPAC name is 5-chloro-6-[methyl(3,3,3-trifluoropropyl)amino]-1H-indole-2,3-dione.
| Compound Name | 5-chloro-6-[methyl(3,3,3-trifluoropropyl)amino]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 79336093 |
| Molecular Formula | C12H10ClF3N2O2 |
| Molecular Weight | 306.67 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 5-chloro-6-[methyl(3,3,3-trifluoropropyl)amino]-1H-indole-2,3-dione |
| SMILES | CN(CCC(F)(F)F)c1cc2c(cc1Cl)C(=O)C(=O)N2 |
| InChI | InChI=1S/C12H10ClF3N2O2/c1-18(3-2-12(14,15)16)9-5-8-6(4-7(9)13)10(19)11(20)17-8/h4-5H,2-3H2,1H3,(H,17,19,20) |
| InChIKey | NBBXMRAYHHMRHI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|