About 2-piperidin-3-ylethyl N,N-diethylcarbamate
2-piperidin-3-ylethyl N,N-diethylcarbamate (PubChem CID 79337440) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-piperidin-3-ylethyl N,N-diethylcarbamate.
Molecular Properties
| Compound Name | 2-piperidin-3-ylethyl N,N-diethylcarbamate |
| PubChem CID | 79337440 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-piperidin-3-ylethyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCCC1CCCNC1 |
| InChI | InChI=1S/C12H24N2O2/c1-3-14(4-2)12(15)16-9-7-11-6-5-8-13-10-11/h11,13H,3-10H2,1-2H3 |
| InChIKey | AJWDRQLJSBKXNE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-3-ylethyl N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-3-ylethyl N,N-diethylcarbamate?
The IUPAC name of 2-piperidin-3-ylethyl N,N-diethylcarbamate (CID 79337440) is 2-piperidin-3-ylethyl N,N-diethylcarbamate.
What is the SMILES notation for 2-piperidin-3-ylethyl N,N-diethylcarbamate?
The canonical SMILES for 2-piperidin-3-ylethyl N,N-diethylcarbamate is CCN(CC)C(=O)OCCC1CCCNC1.
What is the InChIKey of 2-piperidin-3-ylethyl N,N-diethylcarbamate?
The InChIKey is AJWDRQLJSBKXNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-3-14(4-2)12(15)16-9-7-11-6-5-8-13-10-11/h11,13H,3-10H2,1-2H3.
What are the key properties of 2-piperidin-3-ylethyl N,N-diethylcarbamate?
2-piperidin-3-ylethyl N,N-diethylcarbamate has a molecular weight of 228.34 g/mol, XLogP of 1.85, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-3-ylethyl N,N-diethylcarbamate is sourced from PubChem (CID 79337440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).