About 3-aminopropyl piperidine-1-carboxylate
3-aminopropyl piperidine-1-carboxylate (PubChem CID 79337729) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-aminopropyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 3-aminopropyl piperidine-1-carboxylate |
| PubChem CID | 79337729 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 3-aminopropyl piperidine-1-carboxylate |
| SMILES | NCCCOC(=O)N1CCCCC1 |
| InChI | InChI=1S/C9H18N2O2/c10-5-4-8-13-9(12)11-6-2-1-3-7-11/h1-8,10H2 |
| InChIKey | IGBIBCODDSEPSX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropyl piperidine-1-carboxylate?
The IUPAC name of 3-aminopropyl piperidine-1-carboxylate (CID 79337729) is 3-aminopropyl piperidine-1-carboxylate.
What is the SMILES notation for 3-aminopropyl piperidine-1-carboxylate?
The canonical SMILES for 3-aminopropyl piperidine-1-carboxylate is NCCCOC(=O)N1CCCCC1.
What is the InChIKey of 3-aminopropyl piperidine-1-carboxylate?
The InChIKey is IGBIBCODDSEPSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c10-5-4-8-13-9(12)11-6-2-1-3-7-11/h1-8,10H2.
What are the key properties of 3-aminopropyl piperidine-1-carboxylate?
3-aminopropyl piperidine-1-carboxylate has a molecular weight of 186.25 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropyl piperidine-1-carboxylate is sourced from PubChem (CID 79337729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).