About methyl pyrrolidin-3-ylmethyl carbonate
methyl pyrrolidin-3-ylmethyl carbonate (PubChem CID 79337934) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is methyl pyrrolidin-3-ylmethyl carbonate.
Molecular Properties
| Compound Name | methyl pyrrolidin-3-ylmethyl carbonate |
| PubChem CID | 79337934 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | methyl pyrrolidin-3-ylmethyl carbonate |
| SMILES | COC(=O)OCC1CCNC1 |
| InChI | InChI=1S/C7H13NO3/c1-10-7(9)11-5-6-2-3-8-4-6/h6,8H,2-5H2,1H3 |
| InChIKey | RYPLNAMPOJFFLY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl pyrrolidin-3-ylmethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl pyrrolidin-3-ylmethyl carbonate?
The IUPAC name of methyl pyrrolidin-3-ylmethyl carbonate (CID 79337934) is methyl pyrrolidin-3-ylmethyl carbonate.
What is the SMILES notation for methyl pyrrolidin-3-ylmethyl carbonate?
The canonical SMILES for methyl pyrrolidin-3-ylmethyl carbonate is COC(=O)OCC1CCNC1.
What is the InChIKey of methyl pyrrolidin-3-ylmethyl carbonate?
The InChIKey is RYPLNAMPOJFFLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-10-7(9)11-5-6-2-3-8-4-6/h6,8H,2-5H2,1H3.
What are the key properties of methyl pyrrolidin-3-ylmethyl carbonate?
methyl pyrrolidin-3-ylmethyl carbonate has a molecular weight of 159.18 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl pyrrolidin-3-ylmethyl carbonate is sourced from PubChem (CID 79337934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).