About piperidin-4-yl N-propylcarbamate
piperidin-4-yl N-propylcarbamate (PubChem CID 79338098) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is piperidin-4-yl N-propylcarbamate.
Molecular Properties
| Compound Name | piperidin-4-yl N-propylcarbamate |
| PubChem CID | 79338098 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | piperidin-4-yl N-propylcarbamate |
| SMILES | CCCNC(=O)OC1CCNCC1 |
| InChI | InChI=1S/C9H18N2O2/c1-2-5-11-9(12)13-8-3-6-10-7-4-8/h8,10H,2-7H2,1H3,(H,11,12) |
| InChIKey | RPWGXUWBUAJLLV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-4-yl N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl N-propylcarbamate?
The IUPAC name of piperidin-4-yl N-propylcarbamate (CID 79338098) is piperidin-4-yl N-propylcarbamate.
What is the SMILES notation for piperidin-4-yl N-propylcarbamate?
The canonical SMILES for piperidin-4-yl N-propylcarbamate is CCCNC(=O)OC1CCNCC1.
What is the InChIKey of piperidin-4-yl N-propylcarbamate?
The InChIKey is RPWGXUWBUAJLLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-2-5-11-9(12)13-8-3-6-10-7-4-8/h8,10H,2-7H2,1H3,(H,11,12).
What are the key properties of piperidin-4-yl N-propylcarbamate?
piperidin-4-yl N-propylcarbamate has a molecular weight of 186.25 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl N-propylcarbamate is sourced from PubChem (CID 79338098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).