C12H15FN2O2 — CID 79338245
pyrrolidin-3-ylmethyl N-(3-fluorophenyl)carbamate (PubChem CID 79338245) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is pyrrolidin-3-ylmethyl N-(3-fluorophenyl)carbamate.
| Compound Name | pyrrolidin-3-ylmethyl N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 79338245 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | pyrrolidin-3-ylmethyl N-(3-fluorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(F)c1)OCC1CCNC1 |
| InChI | InChI=1S/C12H15FN2O2/c13-10-2-1-3-11(6-10)15-12(16)17-8-9-4-5-14-7-9/h1-3,6,9,14H,4-5,7-8H2,(H,15,16) |
| InChIKey | WWIVJBQOTSJSKU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |