C15H18F3N — CID 79339196
N-[3-methyl-2-[(3,4,5-trifluorophenyl)methylidene]butyl]cyclopropanamine (PubChem CID 79339196) has the molecular formula C15H18F3N and a molecular weight of 269.31 g/mol. Its IUPAC name is N-[3-methyl-2-[(3,4,5-trifluorophenyl)methylidene]butyl]cyclopropanamine.
| Compound Name | N-[3-methyl-2-[(3,4,5-trifluorophenyl)methylidene]butyl]cyclopropanamine |
|---|---|
| PubChem CID | 79339196 |
| Molecular Formula | C15H18F3N |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-[3-methyl-2-[(3,4,5-trifluorophenyl)methylidene]butyl]cyclopropanamine |
| SMILES | CC(C)C(=Cc1cc(F)c(F)c(F)c1)CNC1CC1 |
| InChI | InChI=1S/C15H18F3N/c1-9(2)11(8-19-12-3-4-12)5-10-6-13(16)15(18)14(17)7-10/h5-7,9,12,19H,3-4,8H2,1-2H3 |
| InChIKey | UFPIUFGKGPKKCL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|