About (E)-2,4-dimethyl-N-propylhex-2-en-1-amine
(E)-2,4-dimethyl-N-propylhex-2-en-1-amine (PubChem CID 79340919) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is (E)-2,4-dimethyl-N-propylhex-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-2,4-dimethyl-N-propylhex-2-en-1-amine |
| PubChem CID | 79340919 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (E)-2,4-dimethyl-N-propylhex-2-en-1-amine |
| SMILES | CCCNC/C(C)=C/C(C)CC |
| InChI | InChI=1S/C11H23N/c1-5-7-12-9-11(4)8-10(3)6-2/h8,10,12H,5-7,9H2,1-4H3/b11-8+ |
| InChIKey | WWDPHWHTAJLOBD-DHZHZOJOSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,4-dimethyl-N-propylhex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,4-dimethyl-N-propylhex-2-en-1-amine?
The IUPAC name of (E)-2,4-dimethyl-N-propylhex-2-en-1-amine (CID 79340919) is (E)-2,4-dimethyl-N-propylhex-2-en-1-amine.
What is the SMILES notation for (E)-2,4-dimethyl-N-propylhex-2-en-1-amine?
The canonical SMILES for (E)-2,4-dimethyl-N-propylhex-2-en-1-amine is CCCNC/C(C)=C/C(C)CC.
What is the InChIKey of (E)-2,4-dimethyl-N-propylhex-2-en-1-amine?
The InChIKey is WWDPHWHTAJLOBD-DHZHZOJOSA-N. The full InChI is InChI=1S/C11H23N/c1-5-7-12-9-11(4)8-10(3)6-2/h8,10,12H,5-7,9H2,1-4H3/b11-8+.
What are the key properties of (E)-2,4-dimethyl-N-propylhex-2-en-1-amine?
(E)-2,4-dimethyl-N-propylhex-2-en-1-amine has a molecular weight of 169.31 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,4-dimethyl-N-propylhex-2-en-1-amine is sourced from PubChem (CID 79340919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).