About (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine
(E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine (PubChem CID 79341132) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine |
| PubChem CID | 79341132 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine |
| SMILES | C/C(=C\C1CCC=CO1)CNC(C)C |
| InChI | InChI=1S/C12H21NO/c1-10(2)13-9-11(3)8-12-6-4-5-7-14-12/h5,7-8,10,12-13H,4,6,9H2,1-3H3/b11-8+ |
| InChIKey | JYTJLGADYBPLPB-DHZHZOJOSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine?
The IUPAC name of (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine (CID 79341132) is (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine.
What is the SMILES notation for (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine?
The canonical SMILES for (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine is C/C(=C\C1CCC=CO1)CNC(C)C.
What is the InChIKey of (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine?
The InChIKey is JYTJLGADYBPLPB-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H21NO/c1-10(2)13-9-11(3)8-12-6-4-5-7-14-12/h5,7-8,10,12-13H,4,6,9H2,1-3H3/b11-8+.
What are the key properties of (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine?
(E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine has a molecular weight of 195.31 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,4-dihydro-2H-pyran-2-yl)-2-methyl-N-propan-2-ylprop-2-en-1-amine is sourced from PubChem (CID 79341132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).