About 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine
3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 79341618) has the molecular formula C11H14BrN
and a molecular weight of 240.14 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine |
| PubChem CID | 79341618 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | CNCC(C)=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H14BrN/c1-9(8-13-2)7-10-3-5-11(12)6-4-10/h3-7,13H,8H2,1-2H3 |
| InChIKey | VCWIWQSFEVFWJQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine?
The IUPAC name of 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine (CID 79341618) is 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine.
What is the SMILES notation for 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine?
The canonical SMILES for 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine is CNCC(C)=Cc1ccc(Br)cc1.
What is the InChIKey of 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine?
The InChIKey is VCWIWQSFEVFWJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrN/c1-9(8-13-2)7-10-3-5-11(12)6-4-10/h3-7,13H,8H2,1-2H3.
What are the key properties of 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine?
3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine has a molecular weight of 240.14 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-N,2-dimethylprop-2-en-1-amine is sourced from PubChem (CID 79341618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).